C20H23N3O4S — CID 55352588
4-cyano-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzenesulfonamide (PubChem CID 55352588) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-cyano-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55352588 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-cyano-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzenesulfonamide |
| SMILES | COc1ccc(C(CNS(=O)(=O)c2ccc(C#N)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-26-18-6-4-17(5-7-18)20(23-10-12-27-13-11-23)15-22-28(24,25)19-8-2-16(14-21)3-9-19/h2-9,20,22H,10-13,15H2,1H3 |
| InChIKey | FQOLBILCUABVHJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |