C17H21ClN2O4S2 — CID 30836035
5-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 30836035) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 5-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 30836035 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 5-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc([C@H](CNS(=O)(=O)c2ccc(Cl)s2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-23-14-4-2-13(3-5-14)15(20-8-10-24-11-9-20)12-19-26(21,22)17-7-6-16(18)25-17/h2-7,15,19H,8-12H2,1H3/t15-/m0/s1 |
| InChIKey | PDFGLRIEEFAZSW-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |