C15H25N3O4S — CID 112502616
4-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)ethyl]morpholine (PubChem CID 112502616) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)ethyl]morpholine.
| Compound Name | 4-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)ethyl]morpholine |
|---|---|
| PubChem CID | 112502616 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)ethyl]morpholine |
| SMILES | COc1ccc(C(CNS(=O)(=O)N(C)C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H25N3O4S/c1-17(2)23(19,20)16-12-15(18-8-10-22-11-9-18)13-4-6-14(21-3)7-5-13/h4-7,15-16H,8-12H2,1-3H3 |
| InChIKey | YNQUBMJKDAOBHQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |