C20H26N2O2S — CID 2784014
4-methyl-N-(2-phenyl-2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 2784014) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 4-methyl-N-(2-phenyl-2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-phenyl-2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2784014 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-methyl-N-(2-phenyl-2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-17-10-12-19(13-11-17)25(23,24)21-16-20(18-8-4-2-5-9-18)22-14-6-3-7-15-22/h2,4-5,8-13,20-21H,3,6-7,14-16H2,1H3 |
| InChIKey | AUCNBBXCSKXRCT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |