C23H31N3O4S2 — CID 55559247
N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4-piperidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 55559247) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4-piperidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4-piperidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55559247 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4-piperidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1)N1CCCC1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H31N3O4S2/c27-31(28,24-19-23(25-15-7-8-16-25)20-9-3-1-4-10-20)21-11-13-22(14-12-21)32(29,30)26-17-5-2-6-18-26/h1,3-4,9-14,23-24H,2,5-8,15-19H2 |
| InChIKey | CUNJDUPULIZYOY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |