C24H33N3O4S2 — CID 47068814
N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 47068814) has the molecular formula C24H33N3O4S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 47068814 |
| Molecular Formula | C24H33N3O4S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CC1CCN(C(CNS(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N3O4S2/c1-20-13-17-26(18-14-20)24(21-7-3-2-4-8-21)19-25-32(28,29)22-9-11-23(12-10-22)33(30,31)27-15-5-6-16-27/h2-4,7-12,20,24-25H,5-6,13-19H2,1H3 |
| InChIKey | MIQAQFIRIJYZEP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |