C20H27N3O4S2 — CID 55988368
3-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzene-1,3-disulfonamide (PubChem CID 55988368) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55988368 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 3-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzene-1,3-disulfonamide |
| SMILES | CC1CCN(C(CNS(=O)(=O)c2cccc(S(N)(=O)=O)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N3O4S2/c1-16-10-12-23(13-11-16)20(17-6-3-2-4-7-17)15-22-29(26,27)19-9-5-8-18(14-19)28(21,24)25/h2-9,14,16,20,22H,10-13,15H2,1H3,(H2,21,24,25) |
| InChIKey | VBHHJHKJTRMUOQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |