C25H29N3O4S2 — CID 4830143
N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-phenylethyl]benzenesulfonamide (PubChem CID 4830143) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-phenylethyl]benzenesulfonamide.
| Compound Name | N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4830143 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-phenylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O4S2/c29-33(30,21-22-10-4-1-5-11-22)28-18-16-27(17-19-28)25(23-12-6-2-7-13-23)20-26-34(31,32)24-14-8-3-9-15-24/h1-15,25-26H,16-21H2 |
| InChIKey | GJFARJMYYRUXQA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |