C26H31N3O3S — CID 33054641
N-[(2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 33054641) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[(2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 33054641 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[(2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN([C@@H](CNS(=O)(=O)c3ccc(C)cc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-21-8-14-25(15-9-21)33(30,31)27-20-26(22-6-4-3-5-7-22)29-18-16-28(17-19-29)23-10-12-24(32-2)13-11-23/h3-15,26-27H,16-20H2,1-2H3/t26-/m0/s1 |
| InChIKey | WYDUPMJEJGLJRZ-SANMLTNESA-N |
| XLogP | 3.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|