C26H30FN5O4S — CID 43957211
N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 43957211) has the molecular formula C26H30FN5O4S and a molecular weight of 527.62 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43957211 |
| Molecular Formula | C26H30FN5O4S |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H30FN5O4S/c1-29(2)22-7-3-20(4-8-22)26(19-28-37(35,36)25-13-11-24(12-14-25)32(33)34)31-17-15-30(16-18-31)23-9-5-21(27)6-10-23/h3-14,26,28H,15-19H2,1-2H3 |
| InChIKey | JBWCVTRDQNXDAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|