C21H28ClFN4O2S — CID 43957226
1-chloro-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]methanesulfonamide (PubChem CID 43957226) has the molecular formula C21H28ClFN4O2S and a molecular weight of 455.00 g/mol. Its IUPAC name is 1-chloro-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43957226 |
| Molecular Formula | C21H28ClFN4O2S |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-chloro-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]methanesulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)CCl)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H28ClFN4O2S/c1-25(2)19-7-3-17(4-8-19)21(15-24-30(28,29)16-22)27-13-11-26(12-14-27)20-9-5-18(23)6-10-20/h3-10,21,24H,11-16H2,1-2H3 |
| InChIKey | CTJAMVZCKPPWIP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|