C24H31FN4O3 — CID 43956984
[2-[[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]amino]-2-oxoethyl] acetate (PubChem CID 43956984) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-[[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 43956984 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [2-[[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCC(c1ccc(N(C)C)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H31FN4O3/c1-18(30)32-17-24(31)26-16-23(19-4-8-21(9-5-19)27(2)3)29-14-12-28(13-15-29)22-10-6-20(25)7-11-22/h4-11,23H,12-17H2,1-3H3,(H,26,31) |
| InChIKey | STNGVPKRGCMCSG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|