C28H33FN4O2 — CID 43957003
benzyl N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]carbamate (PubChem CID 43957003) has the molecular formula C28H33FN4O2 and a molecular weight of 476.60 g/mol. Its IUPAC name is benzyl N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 43957003 |
| Molecular Formula | C28H33FN4O2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | benzyl N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]carbamate |
| SMILES | CN(C)c1ccc(C(CNC(=O)OCc2ccccc2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H33FN4O2/c1-31(2)25-12-8-23(9-13-25)27(20-30-28(34)35-21-22-6-4-3-5-7-22)33-18-16-32(17-19-33)26-14-10-24(29)11-15-26/h3-15,27H,16-21H2,1-2H3,(H,30,34) |
| InChIKey | LLENCRIRDCSAMN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|