C29H35N5O2 — CID 43996755
N-benzyl-N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]oxamide (PubChem CID 43996755) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-benzyl-N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]oxamide.
| Compound Name | N-benzyl-N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 43996755 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | N-benzyl-N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C(=O)NCc2ccccc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H35N5O2/c1-32(2)25-15-13-24(14-16-25)27(34-19-17-33(18-20-34)26-11-7-4-8-12-26)22-31-29(36)28(35)30-21-23-9-5-3-6-10-23/h3-16,27H,17-22H2,1-2H3,(H,30,35)(H,31,36) |
| InChIKey | DIJNXPRDAJJQON-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|