C27H38N4O — CID 43956875
N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]cyclohexanecarboxamide (PubChem CID 43956875) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 43956875 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]cyclohexanecarboxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C2CCCCC2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H38N4O/c1-29(2)24-15-13-22(14-16-24)26(21-28-27(32)23-9-5-3-6-10-23)31-19-17-30(18-20-31)25-11-7-4-8-12-25/h4,7-8,11-16,23,26H,3,5-6,9-10,17-21H2,1-2H3,(H,28,32) |
| InChIKey | XBNSLFVFRZTRAM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|