C28H34N6O2 — CID 43996766
N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 43996766) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 43996766 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N'-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C(=O)NCc2cccnc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H34N6O2/c1-32(2)24-12-10-23(11-13-24)26(34-17-15-33(16-18-34)25-8-4-3-5-9-25)21-31-28(36)27(35)30-20-22-7-6-14-29-19-22/h3-14,19,26H,15-18,20-21H2,1-2H3,(H,30,35)(H,31,36) |
| InChIKey | PZVRLWTXXWWVDP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|