C27H31N5O3 — CID 40773845
N-[(4-methoxyphenyl)methyl]-N'-[(2S)-2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide (PubChem CID 40773845) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N'-[(2S)-2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N'-[(2S)-2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 40773845 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N'-[(2S)-2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NC[C@H](c2cccnc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H31N5O3/c1-35-24-11-9-21(10-12-24)18-29-26(33)27(34)30-20-25(22-6-5-13-28-19-22)32-16-14-31(15-17-32)23-7-3-2-4-8-23/h2-13,19,25H,14-18,20H2,1H3,(H,29,33)(H,30,34)/t25-/m1/s1 |
| InChIKey | XOBQMRNXWZGJKI-RUZDIDTESA-N |
| XLogP | 2.39 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|