C21H28N4O — CID 3503405
2-methyl-N-[2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]propanamide (PubChem CID 3503405) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]propanamide.
| Compound Name | 2-methyl-N-[2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 3503405 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-methyl-N-[2-(4-phenylpiperazin-1-yl)-2-pyridin-3-ylethyl]propanamide |
| SMILES | CC(C)C(=O)NCC(c1cccnc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O/c1-17(2)21(26)23-16-20(18-7-6-10-22-15-18)25-13-11-24(12-14-25)19-8-4-3-5-9-19/h3-10,15,17,20H,11-14,16H2,1-2H3,(H,23,26) |
| InChIKey | KELPUSSRSBSTEZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |