C26H27F2N5O2 — CID 27554903
N-[(4-fluorophenyl)methyl]-N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide (PubChem CID 27554903) has the molecular formula C26H27F2N5O2 and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 27554903 |
| Molecular Formula | C26H27F2N5O2 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)NC[C@@H](c1cccnc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H27F2N5O2/c27-21-5-3-19(4-6-21)16-30-25(34)26(35)31-18-24(20-2-1-11-29-17-20)33-14-12-32(13-15-33)23-9-7-22(28)8-10-23/h1-11,17,24H,12-16,18H2,(H,30,34)(H,31,35)/t24-/m0/s1 |
| InChIKey | DGRJZDJZLXLEBS-DEOSSOPVSA-N |
| XLogP | 2.66 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|