C28H32FN5O2 — CID 22517332
N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-phenylpropyl)oxamide (PubChem CID 22517332) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 22517332 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-phenylpropyl)oxamide |
| SMILES | O=C(NCCCc1ccccc1)C(=O)NCC(c1cccnc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H32FN5O2/c29-24-10-12-25(13-11-24)33-16-18-34(19-17-33)26(23-9-5-14-30-20-23)21-32-28(36)27(35)31-15-4-8-22-6-2-1-3-7-22/h1-3,5-7,9-14,20,26H,4,8,15-19,21H2,(H,31,35)(H,32,36) |
| InChIKey | NREONMLFEODMDA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|