C23H31N5O2 — CID 51631275
N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(2-phenylethyl)oxamide (PubChem CID 51631275) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 51631275 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(2-phenylethyl)oxamide |
| SMILES | CCN1CCN([C@@H](CNC(=O)C(=O)NCCc2ccccc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C23H31N5O2/c1-2-27-13-15-28(16-14-27)21(20-9-6-11-24-17-20)18-26-23(30)22(29)25-12-10-19-7-4-3-5-8-19/h3-9,11,17,21H,2,10,12-16,18H2,1H3,(H,25,29)(H,26,30)/t21-/m0/s1 |
| InChIKey | NFTSVIIIYRQOEM-NRFANRHFSA-N |
| XLogP | 1.24 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|