C27H31N5O2 — CID 92680974
N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide (PubChem CID 92680974) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 92680974 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC[C@@H](c2cccnc2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-21-9-11-24(12-10-21)30-27(34)26(33)29-19-25(23-8-5-13-28-18-23)32-16-14-31(15-17-32)20-22-6-3-2-4-7-22/h2-13,18,25H,14-17,19-20H2,1H3,(H,29,33)(H,30,34)/t25-/m0/s1 |
| InChIKey | MQWFCPZWXCFFEH-VWLOTQADSA-N |
| XLogP | 3.00 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|