C26H28FN5O2 — CID 94793790
N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide (PubChem CID 94793790) has the molecular formula C26H28FN5O2 and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 94793790 |
| Molecular Formula | C26H28FN5O2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC[C@H](c2cccnc2)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H28FN5O2/c1-19-8-10-21(11-9-19)30-26(34)25(33)29-18-24(20-5-4-12-28-17-20)32-15-13-31(14-16-32)23-7-3-2-6-22(23)27/h2-12,17,24H,13-16,18H2,1H3,(H,29,33)(H,30,34)/t24-/m1/s1 |
| InChIKey | HAPBOGQRAMZSAH-XMMPIXPASA-N |
| XLogP | 3.15 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|