C26H26FN5O4 — CID 95043704
N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide (PubChem CID 95043704) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 95043704 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
| SMILES | O=C(NC[C@H](c1cccnc1)N1CCN(c2ccccc2F)CC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H26FN5O4/c27-20-5-1-2-6-21(20)31-10-12-32(13-11-31)22(18-4-3-9-28-15-18)16-29-25(33)26(34)30-19-7-8-23-24(14-19)36-17-35-23/h1-9,14-15,22H,10-13,16-17H2,(H,29,33)(H,30,34)/t22-/m1/s1 |
| InChIKey | MOBNCMUFNIIAEF-JOCHJYFZSA-N |
| XLogP | 2.57 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|