C27H29N5O4 — CID 92680998
N'-(1,3-benzodioxol-5-yl)-N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide (PubChem CID 92680998) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 92680998 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[(2R)-2-(4-benzylpiperazin-1-yl)-2-pyridin-3-ylethyl]oxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)N1CCN(Cc2ccccc2)CC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H29N5O4/c33-26(27(34)30-22-8-9-24-25(15-22)36-19-35-24)29-17-23(21-7-4-10-28-16-21)32-13-11-31(12-14-32)18-20-5-2-1-3-6-20/h1-10,15-16,23H,11-14,17-19H2,(H,29,33)(H,30,34)/t23-/m0/s1 |
| InChIKey | VSWBNLDPPONRHH-QHCPKHFHSA-N |
| XLogP | 2.42 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|