C20H24N4O3 — CID 22517260
N-benzyl-N'-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide (PubChem CID 22517260) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-benzyl-N'-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide.
| Compound Name | N-benzyl-N'-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 22517260 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-benzyl-N'-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NCC(c1cccnc1)N1CCOCC1 |
| InChI | InChI=1S/C20H24N4O3/c25-19(22-13-16-5-2-1-3-6-16)20(26)23-15-18(17-7-4-8-21-14-17)24-9-11-27-12-10-24/h1-8,14,18H,9-13,15H2,(H,22,25)(H,23,26) |
| InChIKey | QUYAIDCQWWVGIG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|