C22H29N5O3 — CID 7644945
N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 7644945) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 7644945 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NCc2cccnc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N5O3/c1-26(2)19-7-5-18(6-8-19)20(27-10-12-30-13-11-27)16-25-22(29)21(28)24-15-17-4-3-9-23-14-17/h3-9,14,20H,10-13,15-16H2,1-2H3,(H,24,28)(H,25,29)/t20-/m0/s1 |
| InChIKey | ULVHDVBAZAATTK-FQEVSTJZSA-N |
| XLogP | 0.95 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|