C21H28N6O2 — CID 7087530
N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 7087530) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 7087530 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | N'-[(2R)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CCN1CCN([C@@H](CNC(=O)C(=O)NCc2cccnc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H28N6O2/c1-2-26-9-11-27(12-10-26)19(18-6-4-8-23-15-18)16-25-21(29)20(28)24-14-17-5-3-7-22-13-17/h3-8,13,15,19H,2,9-12,14,16H2,1H3,(H,24,28)(H,25,29)/t19-/m0/s1 |
| InChIKey | JSEGDJVIGALRCF-IBGZPJMESA-N |
| XLogP | 0.59 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|