C24H33N5O3 — CID 92766710
N'-[(2S)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-[2-(4-methoxyphenyl)ethyl]oxamide (PubChem CID 92766710) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N'-[(2S)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-[2-(4-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[(2S)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-[2-(4-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 92766710 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N'-[(2S)-2-(4-ethylpiperazin-1-yl)-2-pyridin-3-ylethyl]-N-[2-(4-methoxyphenyl)ethyl]oxamide |
| SMILES | CCN1CCN([C@H](CNC(=O)C(=O)NCCc2ccc(OC)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C24H33N5O3/c1-3-28-13-15-29(16-14-28)22(20-5-4-11-25-17-20)18-27-24(31)23(30)26-12-10-19-6-8-21(32-2)9-7-19/h4-9,11,17,22H,3,10,12-16,18H2,1-2H3,(H,26,30)(H,27,31)/t22-/m1/s1 |
| InChIKey | SWKIEDUNDYSRCK-JOCHJYFZSA-N |
| XLogP | 1.24 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|