C16H19N3O3 — CID 3241753
N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)furan-2-carboxamide (PubChem CID 3241753) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)furan-2-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3241753 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)furan-2-carboxamide |
| SMILES | O=C(NCC(c1cccnc1)N1CCOCC1)c1ccco1 |
| InChI | InChI=1S/C16H19N3O3/c20-16(15-4-2-8-22-15)18-12-14(13-3-1-5-17-11-13)19-6-9-21-10-7-19/h1-5,8,11,14H,6-7,9-10,12H2,(H,18,20) |
| InChIKey | BWRSXBQALWLEAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |