C15H21N3O4 — CID 45497405
ethyl 2-[(2-morpholin-4-yl-2-pyridin-3-ylethyl)amino]-2-oxoacetate (PubChem CID 45497405) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 2-[(2-morpholin-4-yl-2-pyridin-3-ylethyl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(2-morpholin-4-yl-2-pyridin-3-ylethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 45497405 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl 2-[(2-morpholin-4-yl-2-pyridin-3-ylethyl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC(c1cccnc1)N1CCOCC1 |
| InChI | InChI=1S/C15H21N3O4/c1-2-22-15(20)14(19)17-11-13(12-4-3-5-16-10-12)18-6-8-21-9-7-18/h3-5,10,13H,2,6-9,11H2,1H3,(H,17,19) |
| InChIKey | PVFGGWOACNZHNW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|