C19H21FN4O3 — CID 92680930
N'-(4-fluorophenyl)-N-[(2R)-2-morpholin-4-yl-2-pyridin-3-ylethyl]oxamide (PubChem CID 92680930) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-[(2R)-2-morpholin-4-yl-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N'-(4-fluorophenyl)-N-[(2R)-2-morpholin-4-yl-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 92680930 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N'-(4-fluorophenyl)-N-[(2R)-2-morpholin-4-yl-2-pyridin-3-ylethyl]oxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)N1CCOCC1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O3/c20-15-3-5-16(6-4-15)23-19(26)18(25)22-13-17(14-2-1-7-21-12-14)24-8-10-27-11-9-24/h1-7,12,17H,8-11,13H2,(H,22,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | VIAODQUAHBWNRP-KRWDZBQOSA-N |
| XLogP | 1.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|