C19H24N6O3 — CID 166401105
N'-[6-(methylamino)-3-pyridinyl]-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide (PubChem CID 166401105) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N'-[6-(methylamino)-3-pyridinyl]-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide.
| Compound Name | N'-[6-(methylamino)-3-pyridinyl]-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 166401105 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N'-[6-(methylamino)-3-pyridinyl]-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)oxamide |
| SMILES | CNc1ccc(NC(=O)C(=O)NCC(c2cccnc2)N2CCOCC2)cn1 |
| InChI | InChI=1S/C19H24N6O3/c1-20-17-5-4-15(12-22-17)24-19(27)18(26)23-13-16(14-3-2-6-21-11-14)25-7-9-28-10-8-25/h2-6,11-12,16H,7-10,13H2,1H3,(H,20,22)(H,23,26)(H,24,27) |
| InChIKey | PBEZDXFMRKECAX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|