C19H24N4OS — CID 92661893
1-benzyl-3-[(2S)-2-morpholin-4-yl-2-pyridin-3-ylethyl]thiourea (PubChem CID 92661893) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-benzyl-3-[(2S)-2-morpholin-4-yl-2-pyridin-3-ylethyl]thiourea.
| Compound Name | 1-benzyl-3-[(2S)-2-morpholin-4-yl-2-pyridin-3-ylethyl]thiourea |
|---|---|
| PubChem CID | 92661893 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-benzyl-3-[(2S)-2-morpholin-4-yl-2-pyridin-3-ylethyl]thiourea |
| SMILES | S=C(NCc1ccccc1)NC[C@H](c1cccnc1)N1CCOCC1 |
| InChI | InChI=1S/C19H24N4OS/c25-19(21-13-16-5-2-1-3-6-16)22-15-18(17-7-4-8-20-14-17)23-9-11-24-12-10-23/h1-8,14,18H,9-13,15H2,(H2,21,22,25)/t18-/m1/s1 |
| InChIKey | PNLYXMMIFVTCLX-GOSISDBHSA-N |
| XLogP | 2.12 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|