C26H27ClFN5O2 — CID 95043712
N'-(5-chloro-2-methylphenyl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide (PubChem CID 95043712) has the molecular formula C26H27ClFN5O2 and a molecular weight of 495.99 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 95043712 |
| Molecular Formula | C26H27ClFN5O2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)NC[C@H](c1cccnc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H27ClFN5O2/c1-18-8-9-20(27)15-22(18)31-26(35)25(34)30-17-24(19-5-4-10-29-16-19)33-13-11-32(12-14-33)23-7-3-2-6-21(23)28/h2-10,15-16,24H,11-14,17H2,1H3,(H,30,34)(H,31,35)/t24-/m1/s1 |
| InChIKey | GMMIUQBSYIIDSE-XMMPIXPASA-N |
| XLogP | 3.80 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|