C26H35FN6O3 — CID 22517341
N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 22517341) has the molecular formula C26H35FN6O3 and a molecular weight of 498.60 g/mol. Its IUPAC name is N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 22517341 |
| Molecular Formula | C26H35FN6O3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)NCC(c1cccnc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H35FN6O3/c27-22-6-1-2-7-23(22)32-11-13-33(14-12-32)24(21-5-3-8-28-19-21)20-30-26(35)25(34)29-9-4-10-31-15-17-36-18-16-31/h1-3,5-8,19,24H,4,9-18,20H2,(H,29,34)(H,30,35) |
| InChIKey | SFWKMNZYDBNPAS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|