C19H27FN4O3 — CID 108518536
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide (PubChem CID 108518536) has the molecular formula C19H27FN4O3 and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108518536 |
| Molecular Formula | C19H27FN4O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN4O3/c20-16-4-1-2-5-17(16)23-8-10-24(11-9-23)19(26)18(25)21-6-3-7-22-12-14-27-15-13-22/h1-2,4-5H,3,6-15H2,(H,21,25) |
| InChIKey | LKMOTHCNWUXOEC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|