C23H29FN4O2 — CID 42390054
N'-(2,6-dimethylphenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42390054) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42390054 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H29FN4O2/c1-17-7-5-8-18(2)21(17)26-23(30)22(29)25-11-6-12-27-13-15-28(16-14-27)20-10-4-3-9-19(20)24/h3-5,7-10H,6,11-16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | VBNJCTWGICFWCC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|