C21H24FN5O4 — CID 42390084
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(3-nitrophenyl)oxamide (PubChem CID 42390084) has the molecular formula C21H24FN5O4 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(3-nitrophenyl)oxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 42390084 |
| Molecular Formula | C21H24FN5O4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(3-nitrophenyl)oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24FN5O4/c22-18-7-1-2-8-19(18)26-13-11-25(12-14-26)10-4-9-23-20(28)21(29)24-16-5-3-6-17(15-16)27(30)31/h1-3,5-8,15H,4,9-14H2,(H,23,28)(H,24,29) |
| InChIKey | XICBRTLSUMFXQA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|