C18H27FN4O2 — CID 42390042
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-propan-2-yloxamide (PubChem CID 42390042) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-propan-2-yloxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 42390042 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H27FN4O2/c1-14(2)21-18(25)17(24)20-8-5-9-22-10-12-23(13-11-22)16-7-4-3-6-15(16)19/h3-4,6-7,14H,5,8-13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | YWISHXWYNJXGRA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|