C15H21FN4O2 — CID 42269225
N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-N-methyloxamide (PubChem CID 42269225) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-N-methyloxamide.
| Compound Name | N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-N-methyloxamide |
|---|---|
| PubChem CID | 42269225 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N'-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H21FN4O2/c1-17-14(21)15(22)18-6-7-19-8-10-20(11-9-19)13-5-3-2-4-12(13)16/h2-5H,6-11H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | ARGHFCDPGMZWSF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|