C21H22FN5O2 — CID 42269158
N'-(2-cyanophenyl)-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 42269158) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(2-cyanophenyl)-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 42269158 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)NCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H22FN5O2/c22-17-6-2-4-8-19(17)27-13-11-26(12-14-27)10-9-24-20(28)21(29)25-18-7-3-1-5-16(18)15-23/h1-8H,9-14H2,(H,24,28)(H,25,29) |
| InChIKey | KJSMMKDQHSCXGZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|