C22H26FN5O4 — CID 42390086
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-methyl-4-nitrophenyl)oxamide (PubChem CID 42390086) has the molecular formula C22H26FN5O4 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-methyl-4-nitrophenyl)oxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-methyl-4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 42390086 |
| Molecular Formula | C22H26FN5O4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-methyl-4-nitrophenyl)oxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H26FN5O4/c1-16-15-17(28(31)32)7-8-19(16)25-22(30)21(29)24-9-4-10-26-11-13-27(14-12-26)20-6-3-2-5-18(20)23/h2-3,5-8,15H,4,9-14H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | HZZBBKINUNHXRG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|