C23H30FN3O4 — CID 42224164
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 42224164) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 42224164 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCN2CCN(c3ccccc3F)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H30FN3O4/c1-29-20-15-17(16-21(30-2)22(20)31-3)23(28)25-9-6-10-26-11-13-27(14-12-26)19-8-5-4-7-18(19)24/h4-5,7-8,15-16H,6,9-14H2,1-3H3,(H,25,28) |
| InChIKey | MOYPWGUIRQQMCB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|