C21H24FN3O3 — CID 42224330
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42224330) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42224330 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H24FN3O3/c22-17-4-1-2-5-18(17)25-12-10-24(11-13-25)9-3-8-23-21(26)16-6-7-19-20(14-16)28-15-27-19/h1-2,4-7,14H,3,8-13,15H2,(H,23,26) |
| InChIKey | IOAIBSFGRHOGSG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|