C23H25FN4OS — CID 53119705
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-thiophen-2-ylpyridine-4-carboxamide (PubChem CID 53119705) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-thiophen-2-ylpyridine-4-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-thiophen-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 53119705 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-thiophen-2-ylpyridine-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)c1ccnc(-c2cccs2)c1 |
| InChI | InChI=1S/C23H25FN4OS/c24-19-5-1-2-6-21(19)28-14-12-27(13-15-28)11-4-9-26-23(29)18-8-10-25-20(17-18)22-7-3-16-30-22/h1-3,5-8,10,16-17H,4,9,11-15H2,(H,26,29) |
| InChIKey | HPAPCADQQSBYQM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|