C19H25N3OS — CID 53036766
N-[3-(2-methylpiperidin-1-yl)propyl]-2-thiophen-2-ylpyridine-4-carboxamide (PubChem CID 53036766) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-2-thiophen-2-ylpyridine-4-carboxamide.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-2-thiophen-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 53036766 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-2-thiophen-2-ylpyridine-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1ccnc(-c2cccs2)c1 |
| InChI | InChI=1S/C19H25N3OS/c1-15-6-2-3-11-22(15)12-5-9-21-19(23)16-8-10-20-17(14-16)18-7-4-13-24-18/h4,7-8,10,13-15H,2-3,5-6,9,11-12H2,1H3,(H,21,23) |
| InChIKey | HQPKEZIGBTXICL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|