C21H29N3O2S — CID 51266645
N-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide (PubChem CID 51266645) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 51266645 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
| SMILES | Cc1nc(COc2cccc(C(=O)NCCCN3CCCCC3C)c2)cs1 |
| InChI | InChI=1S/C21H29N3O2S/c1-16-7-3-4-11-24(16)12-6-10-22-21(25)18-8-5-9-20(13-18)26-14-19-15-27-17(2)23-19/h5,8-9,13,15-16H,3-4,6-7,10-12,14H2,1-2H3,(H,22,25) |
| InChIKey | QYKCFOQHKBCBNW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|