C18H25N3O4S2 — CID 55693772
N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide (PubChem CID 55693772) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide.
| Compound Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 55693772 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1cccc(OCc2csc(C)n2)c1 |
| InChI | InChI=1S/C18H25N3O4S2/c1-4-27(23,24)21(3)10-6-9-19-18(22)15-7-5-8-17(11-15)25-12-16-13-26-14(2)20-16/h5,7-8,11,13H,4,6,9-10,12H2,1-3H3,(H,19,22) |
| InChIKey | RKQFHWQEVADPRP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|