C21H21N5O3S — CID 55863880
3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]benzamide (PubChem CID 55863880) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]benzamide.
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55863880 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]benzamide |
| SMILES | Cc1nc(COc2cccc(C(=O)NCCCn3nc4ccccn4c3=O)c2)cs1 |
| InChI | InChI=1S/C21H21N5O3S/c1-15-23-17(14-30-15)13-29-18-7-4-6-16(12-18)20(27)22-9-5-11-26-21(28)25-10-3-2-8-19(25)24-26/h2-4,6-8,10,12,14H,5,9,11,13H2,1H3,(H,22,27) |
| InChIKey | LEZJHXUFKVAQFF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|